C12H20N2O4 — CID 114284514
(2R)-1-(4-methoxypiperidine-4-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 114284514) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2R)-1-(4-methoxypiperidine-4-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(4-methoxypiperidine-4-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114284514 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2R)-1-(4-methoxypiperidine-4-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COC1(C(=O)N2CCC[C@@H]2C(=O)O)CCNCC1 |
| InChI | InChI=1S/C12H20N2O4/c1-18-12(4-6-13-7-5-12)11(17)14-8-2-3-9(14)10(15)16/h9,13H,2-8H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | KYFSGJRRNWIBRD-SECBINFHSA-N |
| XLogP | -0.17 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |