C11H18N4O2 — CID 114284665
N-[2-(hydroxymethyl)cyclohexyl]-2-methyltriazole-4-carboxamide (PubChem CID 114284665) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)cyclohexyl]-2-methyltriazole-4-carboxamide.
| Compound Name | N-[2-(hydroxymethyl)cyclohexyl]-2-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 114284665 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-[2-(hydroxymethyl)cyclohexyl]-2-methyltriazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC2CCCCC2CO)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-15-12-6-10(14-15)11(17)13-9-5-3-2-4-8(9)7-16/h6,8-9,16H,2-5,7H2,1H3,(H,13,17) |
| InChIKey | XQYIHKLBSZVWEH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |