C16H28N2 — CID 114284861
3,5-dimethyl-N-propyl-1-pyridin-3-ylhexan-2-amine (PubChem CID 114284861) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 3,5-dimethyl-N-propyl-1-pyridin-3-ylhexan-2-amine.
| Compound Name | 3,5-dimethyl-N-propyl-1-pyridin-3-ylhexan-2-amine |
|---|---|
| PubChem CID | 114284861 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 3,5-dimethyl-N-propyl-1-pyridin-3-ylhexan-2-amine |
| SMILES | CCCNC(Cc1cccnc1)C(C)CC(C)C |
| InChI | InChI=1S/C16H28N2/c1-5-8-18-16(14(4)10-13(2)3)11-15-7-6-9-17-12-15/h6-7,9,12-14,16,18H,5,8,10-11H2,1-4H3 |
| InChIKey | GTCDZIMDUDSIOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |