C16H26BrN — CID 114284863
1-(2-bromophenyl)-N-ethyl-3,5-dimethylhexan-2-amine (PubChem CID 114284863) has the molecular formula C16H26BrN and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-ethyl-3,5-dimethylhexan-2-amine.
| Compound Name | 1-(2-bromophenyl)-N-ethyl-3,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 114284863 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(2-bromophenyl)-N-ethyl-3,5-dimethylhexan-2-amine |
| SMILES | CCNC(Cc1ccccc1Br)C(C)CC(C)C |
| InChI | InChI=1S/C16H26BrN/c1-5-18-16(13(4)10-12(2)3)11-14-8-6-7-9-15(14)17/h6-9,12-13,16,18H,5,10-11H2,1-4H3 |
| InChIKey | SPYZXVMWGYJMDP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |