About 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one
6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 11428656) has the molecular formula C19H13F3N4O
and a molecular weight of 370.33 g/mol. Its IUPAC name is 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one |
| PubChem CID | 11428656 |
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1cccnc1-c1ccc2c(=O)n(-c3ccc(C(F)(F)F)cc3)[nH]c2n1 |
| InChI | InChI=1S/C19H13F3N4O/c1-11-3-2-10-23-16(11)15-9-8-14-17(24-15)25-26(18(14)27)13-6-4-12(5-7-13)19(20,21)22/h2-10H,1H3,(H,24,25) |
| InChIKey | JBKBYCPLTXERTR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one?
The IUPAC name of 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one (CID 11428656) is 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one.
What is the SMILES notation for 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one?
The canonical SMILES for 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one is Cc1cccnc1-c1ccc2c(=O)n(-c3ccc(C(F)(F)F)cc3)[nH]c2n1.
What is the InChIKey of 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one?
The InChIKey is JBKBYCPLTXERTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N4O/c1-11-3-2-10-23-16(11)15-9-8-14-17(24-15)25-26(18(14)27)13-6-4-12(5-7-13)19(20,21)22/h2-10H,1H3,(H,24,25).
What are the key properties of 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one?
6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one has a molecular weight of 370.33 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-one is sourced from PubChem (CID 11428656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).