C11H13NO5S2 — CID 114286986
7-methylsulfonyl-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine 2,2-dioxide (PubChem CID 114286986) has the molecular formula C11H13NO5S2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 7-methylsulfonyl-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine 2,2-dioxide.
| Compound Name | 7-methylsulfonyl-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine 2,2-dioxide |
|---|---|
| PubChem CID | 114286986 |
| Molecular Formula | C11H13NO5S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 7-methylsulfonyl-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine 2,2-dioxide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)NC1CS(=O)(=O)CC1O2 |
| InChI | InChI=1S/C11H13NO5S2/c1-18(13,14)7-2-3-10-8(4-7)12-9-5-19(15,16)6-11(9)17-10/h2-4,9,11-12H,5-6H2,1H3 |
| InChIKey | PYEXRRGUSFDVAG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |