C13H26O8P2 — CID 11428712
[(1R,4S)-4-diethoxyphosphoryloxycyclopent-2-en-1-yl] diethyl phosphate (PubChem CID 11428712) has the molecular formula C13H26O8P2 and a molecular weight of 372.29 g/mol. Its IUPAC name is [(1R,4S)-4-diethoxyphosphoryloxycyclopent-2-en-1-yl] diethyl phosphate.
| Compound Name | [(1R,4S)-4-diethoxyphosphoryloxycyclopent-2-en-1-yl] diethyl phosphate |
|---|---|
| PubChem CID | 11428712 |
| Molecular Formula | C13H26O8P2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(1R,4S)-4-diethoxyphosphoryloxycyclopent-2-en-1-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@H]1C=C[C@H](OP(=O)(OCC)OCC)C1 |
| InChI | InChI=1S/C13H26O8P2/c1-5-16-22(14,17-6-2)20-12-9-10-13(11-12)21-23(15,18-7-3)19-8-4/h9-10,12-13H,5-8,11H2,1-4H3/t12-,13+ |
| InChIKey | MJYNPIUIHKINRK-BETUJISGSA-N |
| XLogP | 4.08 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|