C14H16N4O — CID 114287772
3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carbonitrile (PubChem CID 114287772) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carbonitrile.
| Compound Name | 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114287772 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1N1CCC2NC(=O)CCC2C1 |
| InChI | InChI=1S/C14H16N4O/c15-7-10-3-5-16-8-13(10)18-6-4-12-11(9-18)1-2-14(19)17-12/h3,5,8,11-12H,1-2,4,6,9H2,(H,17,19) |
| InChIKey | YLKRRQDPWKUUAD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |