C17H24N4O2S2 — CID 11428951
1-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-2-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 11428951) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-2-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-2-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 11428951 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-2-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1cnc(CSN2CCC(C(N)=O)CC2c2nccs2)o1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-17(2,3)13-9-20-14(23-13)10-25-21-6-4-11(15(18)22)8-12(21)16-19-5-7-24-16/h5,7,9,11-12H,4,6,8,10H2,1-3H3,(H2,18,22) |
| InChIKey | PIEFGULYFGKWHK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|