C22H42O3Si — CID 11429012
4-[(2R,3S,6R)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-3,6-dihydro-2H-pyran-6-yl]butanal (PubChem CID 11429012) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is 4-[(2R,3S,6R)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-3,6-dihydro-2H-pyran-6-yl]butanal.
| Compound Name | 4-[(2R,3S,6R)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-3,6-dihydro-2H-pyran-6-yl]butanal |
|---|---|
| PubChem CID | 11429012 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 4-[(2R,3S,6R)-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-3,6-dihydro-2H-pyran-6-yl]butanal |
| SMILES | CC(C)[Si](OCCC[C@H]1O[C@H](CCCC=O)C=C[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-17(2)26(18(3)4,19(5)6)24-16-10-12-22-20(7)13-14-21(25-22)11-8-9-15-23/h13-15,17-22H,8-12,16H2,1-7H3/t20-,21+,22+/m0/s1 |
| InChIKey | PYPVFNQNZPOEON-BHDDXSALSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|