C10H18N4O — CID 114290367
2-(aminomethyl)-2-methyl-N-(1-methylpyrazol-4-yl)butanamide (PubChem CID 114290367) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(aminomethyl)-2-methyl-N-(1-methylpyrazol-4-yl)butanamide.
| Compound Name | 2-(aminomethyl)-2-methyl-N-(1-methylpyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 114290367 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-(aminomethyl)-2-methyl-N-(1-methylpyrazol-4-yl)butanamide |
| SMILES | CCC(C)(CN)C(=O)Nc1cnn(C)c1 |
| InChI | InChI=1S/C10H18N4O/c1-4-10(2,7-11)9(15)13-8-5-12-14(3)6-8/h5-6H,4,7,11H2,1-3H3,(H,13,15) |
| InChIKey | LAVLKMDSIYMUAC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |