C20H20O8 — CID 11429153
2,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid (PubChem CID 11429153) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is 2,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11429153 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2,4-bis(4-hydroxy-3-methoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
| SMILES | COc1cc(C2C(C(=O)O)C(c3ccc(O)c(OC)c3)C2C(=O)O)ccc1O |
| InChI | InChI=1S/C20H20O8/c1-27-13-7-9(3-5-11(13)21)15-17(19(23)24)16(18(15)20(25)26)10-4-6-12(22)14(8-10)28-2/h3-8,15-18,21-22H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | UHCWQMZMXZKYAU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |