C14H27N3OS — CID 114292186
2-carbamothioyl-2-methyl-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]butanamide (PubChem CID 114292186) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-carbamothioyl-2-methyl-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]butanamide.
| Compound Name | 2-carbamothioyl-2-methyl-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 114292186 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-carbamothioyl-2-methyl-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]butanamide |
| SMILES | CCC(C)(C(=O)NCC1CCN(C(C)C)C1)C(N)=S |
| InChI | InChI=1S/C14H27N3OS/c1-5-14(4,12(15)19)13(18)16-8-11-6-7-17(9-11)10(2)3/h10-11H,5-9H2,1-4H3,(H2,15,19)(H,16,18) |
| InChIKey | ZFZPKBNSYNDWJP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|