C10H17F3N2OS — CID 114292380
2-carbamothioyl-N,2-dimethyl-N-(3,3,3-trifluoropropyl)butanamide (PubChem CID 114292380) has the molecular formula C10H17F3N2OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-carbamothioyl-N,2-dimethyl-N-(3,3,3-trifluoropropyl)butanamide.
| Compound Name | 2-carbamothioyl-N,2-dimethyl-N-(3,3,3-trifluoropropyl)butanamide |
|---|---|
| PubChem CID | 114292380 |
| Molecular Formula | C10H17F3N2OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-carbamothioyl-N,2-dimethyl-N-(3,3,3-trifluoropropyl)butanamide |
| SMILES | CCC(C)(C(=O)N(C)CCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C10H17F3N2OS/c1-4-9(2,7(14)17)8(16)15(3)6-5-10(11,12)13/h4-6H2,1-3H3,(H2,14,17) |
| InChIKey | KEOZPDKCLLLZCF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|