C11H20N2O3S3 — CID 114292395
2-methyl-2-(3-methylsulfonylthiomorpholine-4-carbonyl)butanethioamide (PubChem CID 114292395) has the molecular formula C11H20N2O3S3 and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-methyl-2-(3-methylsulfonylthiomorpholine-4-carbonyl)butanethioamide.
| Compound Name | 2-methyl-2-(3-methylsulfonylthiomorpholine-4-carbonyl)butanethioamide |
|---|---|
| PubChem CID | 114292395 |
| Molecular Formula | C11H20N2O3S3 |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-methyl-2-(3-methylsulfonylthiomorpholine-4-carbonyl)butanethioamide |
| SMILES | CCC(C)(C(=O)N1CCSCC1S(C)(=O)=O)C(N)=S |
| InChI | InChI=1S/C11H20N2O3S3/c1-4-11(2,9(12)17)10(14)13-5-6-18-7-8(13)19(3,15)16/h8H,4-7H2,1-3H3,(H2,12,17) |
| InChIKey | VVARYOQXQLIIAO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|