C15H13ClF3N3O3S — CID 1142926
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-pyridin-3-ylacetamide (PubChem CID 1142926) has the molecular formula C15H13ClF3N3O3S and a molecular weight of 407.80 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 1142926 |
| Molecular Formula | C15H13ClF3N3O3S |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-pyridin-3-ylacetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccnc1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3N3O3S/c1-26(24,25)22(9-14(23)21-10-3-2-6-20-8-10)11-4-5-13(16)12(7-11)15(17,18)19/h2-8H,9H2,1H3,(H,21,23) |
| InChIKey | UYNWTYUHLUHBJM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |