About N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide
N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide (PubChem CID 114293033) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide |
| PubChem CID | 114293033 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)NC1CCC(C)(C)CC1)C(N)=NO |
| InChI | InChI=1S/C14H27N3O2/c1-5-14(4,11(15)17-19)12(18)16-10-6-8-13(2,3)9-7-10/h10,19H,5-9H2,1-4H3,(H2,15,17)(H,16,18) |
| InChIKey | MSPSRYHKNKGRRS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The IUPAC name of N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide (CID 114293033) is N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide is CCC(C)(C(=O)NC1CCC(C)(C)CC1)C(N)=NO.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
The InChIKey is MSPSRYHKNKGRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-5-14(4,11(15)17-19)12(18)16-10-6-8-13(2,3)9-7-10/h10,19H,5-9H2,1-4H3,(H2,15,17)(H,16,18).
What are the key properties of N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide?
N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide has a molecular weight of 269.39 g/mol, XLogP of 2.23, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)-2-(N'-hydroxycarbamimidoyl)-2-methylbutanamide is sourced from PubChem (CID 114293033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).