C12H18BrNO3S — CID 114293806
N-(1-bromo-2-methylbutan-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 114293806) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is N-(1-bromo-2-methylbutan-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(1-bromo-2-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114293806 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(1-bromo-2-methylbutan-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | CCC(C)(CBr)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18BrNO3S/c1-4-12(2,9-13)14-18(15,16)11-7-5-10(17-3)6-8-11/h5-8,14H,4,9H2,1-3H3 |
| InChIKey | LABOUOUSMDMAFE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|