C9H16BrF2NO2S — CID 114293913
N-[1-(bromomethyl)-3-methylcyclohexyl]-1,1-difluoromethanesulfonamide (PubChem CID 114293913) has the molecular formula C9H16BrF2NO2S and a molecular weight of 320.20 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 114293913 |
| Molecular Formula | C9H16BrF2NO2S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1,1-difluoromethanesulfonamide |
| SMILES | CC1CCCC(CBr)(NS(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C9H16BrF2NO2S/c1-7-3-2-4-9(5-7,6-10)13-16(14,15)8(11)12/h7-8,13H,2-6H2,1H3 |
| InChIKey | STGMWSPGFFCCMY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|