C21H40O3Si2 — CID 11429396
ethyl (E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-8-trimethylsilyloct-2-en-7-ynoate (PubChem CID 11429396) has the molecular formula C21H40O3Si2 and a molecular weight of 396.72 g/mol. Its IUPAC name is ethyl (E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-8-trimethylsilyloct-2-en-7-ynoate.
| Compound Name | ethyl (E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-8-trimethylsilyloct-2-en-7-ynoate |
|---|---|
| PubChem CID | 11429396 |
| Molecular Formula | C21H40O3Si2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | ethyl (E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-8-trimethylsilyloct-2-en-7-ynoate |
| SMILES | CCOC(=O)/C=C/CC(C)(C)C(C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si2/c1-12-23-19(22)14-13-16-21(5,6)18(15-17-25(7,8)9)24-26(10,11)20(2,3)4/h13-14,18H,12,16H2,1-11H3/b14-13+ |
| InChIKey | SWMSLMLTMILJIB-BUHFOSPRSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|