C11H12ClF2NO — CID 114294264
N-(1-chlorobutan-2-yl)-3,4-difluorobenzamide (PubChem CID 114294264) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is N-(1-chlorobutan-2-yl)-3,4-difluorobenzamide.
| Compound Name | N-(1-chlorobutan-2-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 114294264 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-(1-chlorobutan-2-yl)-3,4-difluorobenzamide |
| SMILES | CCC(CCl)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12ClF2NO/c1-2-8(6-12)15-11(16)7-3-4-9(13)10(14)5-7/h3-5,8H,2,6H2,1H3,(H,15,16) |
| InChIKey | TWNBCIOJKRIQDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|