C9H16ClNO — CID 114294679
N-(1-chlorobutan-2-yl)-2-methylcyclopropane-1-carboxamide (PubChem CID 114294679) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is N-(1-chlorobutan-2-yl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(1-chlorobutan-2-yl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114294679 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-(1-chlorobutan-2-yl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CCC(CCl)NC(=O)C1CC1C |
| InChI | InChI=1S/C9H16ClNO/c1-3-7(5-10)11-9(12)8-4-6(8)2/h6-8H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | YSEFNJAKMCKTOH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|