C14H19BrN2O3S — CID 114295839
N-[4-[(4-bromocyclohexyl)sulfamoyl]phenyl]acetamide (PubChem CID 114295839) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is N-[4-[(4-bromocyclohexyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-bromocyclohexyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 114295839 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-[4-[(4-bromocyclohexyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCC(Br)CC2)cc1 |
| InChI | InChI=1S/C14H19BrN2O3S/c1-10(18)16-12-6-8-14(9-7-12)21(19,20)17-13-4-2-11(15)3-5-13/h6-9,11,13,17H,2-5H2,1H3,(H,16,18) |
| InChIKey | YRKDGDVKJFYLLM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|