C21H23F3N4O — CID 11429605
6-methyl-9-pentan-3-yl-3-[4-(trifluoromethyl)phenyl]-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 11429605) has the molecular formula C21H23F3N4O and a molecular weight of 404.44 g/mol. Its IUPAC name is 6-methyl-9-pentan-3-yl-3-[4-(trifluoromethyl)phenyl]-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 6-methyl-9-pentan-3-yl-3-[4-(trifluoromethyl)phenyl]-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 11429605 |
| Molecular Formula | C21H23F3N4O |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-methyl-9-pentan-3-yl-3-[4-(trifluoromethyl)phenyl]-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CCC(CC)N1CCn2c(=O)n(-c3ccc(C(F)(F)F)cc3)c3nc(C)cc1c32 |
| InChI | InChI=1S/C21H23F3N4O/c1-4-15(5-2)26-10-11-27-18-17(26)12-13(3)25-19(18)28(20(27)29)16-8-6-14(7-9-16)21(22,23)24/h6-9,12,15H,4-5,10-11H2,1-3H3 |
| InChIKey | XOTPNDIXHQGKHW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |