C11H20ClNO — CID 114296561
N-(2-chloropropyl)-1-ethylcyclopentane-1-carboxamide (PubChem CID 114296561) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is N-(2-chloropropyl)-1-ethylcyclopentane-1-carboxamide.
| Compound Name | N-(2-chloropropyl)-1-ethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114296561 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(2-chloropropyl)-1-ethylcyclopentane-1-carboxamide |
| SMILES | CCC1(C(=O)NCC(C)Cl)CCCC1 |
| InChI | InChI=1S/C11H20ClNO/c1-3-11(6-4-5-7-11)10(14)13-8-9(2)12/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | CTNGUSPRDFLRFV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|