C22H30O7 — CID 11429661
[(2R)-4-[(3S,5R)-3,5-dihydroxy-5-prop-2-ynylcyclopenten-1-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-ynyl] 2,2-dimethylpropanoate (PubChem CID 11429661) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(2R)-4-[(3S,5R)-3,5-dihydroxy-5-prop-2-ynylcyclopenten-1-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-4-[(3S,5R)-3,5-dihydroxy-5-prop-2-ynylcyclopenten-1-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11429661 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(2R)-4-[(3S,5R)-3,5-dihydroxy-5-prop-2-ynylcyclopenten-1-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@@]1(O)C[C@H](O)C=C1C#C[C@@](O)(COC(=O)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H30O7/c1-7-9-21(25)12-16(23)11-15(21)8-10-22(26,14-27-18(24)19(2,3)4)17-13-28-20(5,6)29-17/h1,11,16-17,23,25-26H,9,12-14H2,2-6H3/t16-,17+,21-,22-/m1/s1 |
| InChIKey | DSKAIDAPIRPYKX-WOSNLTMFSA-N |
| XLogP | 0.91 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|