C13H13ClF2N2O3 — CID 114296950
N-(4-chlorocyclohexyl)-4,5-difluoro-2-nitrobenzamide (PubChem CID 114296950) has the molecular formula C13H13ClF2N2O3 and a molecular weight of 318.71 g/mol. Its IUPAC name is N-(4-chlorocyclohexyl)-4,5-difluoro-2-nitrobenzamide.
| Compound Name | N-(4-chlorocyclohexyl)-4,5-difluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 114296950 |
| Molecular Formula | C13H13ClF2N2O3 |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(4-chlorocyclohexyl)-4,5-difluoro-2-nitrobenzamide |
| SMILES | O=C(NC1CCC(Cl)CC1)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13ClF2N2O3/c14-7-1-3-8(4-2-7)17-13(19)9-5-10(15)11(16)6-12(9)18(20)21/h5-8H,1-4H2,(H,17,19) |
| InChIKey | GNSKJJMAVVOUHC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|