C22H24F4N2O — CID 11429711
N-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]-3,3-dimethylbutanamide (PubChem CID 11429711) has the molecular formula C22H24F4N2O and a molecular weight of 408.44 g/mol. Its IUPAC name is N-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 11429711 |
| Molecular Formula | C22H24F4N2O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C22H24F4N2O/c1-21(2,3)12-20(29)27-16-5-7-19-15(11-16)8-9-28(19)13-14-4-6-17(18(23)10-14)22(24,25)26/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,27,29) |
| InChIKey | SYJPKVCEZJKYPM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|