C23H26N2O3S — CID 11429783
3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-thiophen-2-ylindole-6-carboxylic acid (PubChem CID 11429783) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-thiophen-2-ylindole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-thiophen-2-ylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 11429783 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-thiophen-2-ylindole-6-carboxylic acid |
| SMILES | CN(C)C(=O)Cn1c(-c2cccs2)c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C23H26N2O3S/c1-24(2)20(26)14-25-18-13-16(23(27)28)10-11-17(18)21(15-7-4-3-5-8-15)22(25)19-9-6-12-29-19/h6,9-13,15H,3-5,7-8,14H2,1-2H3,(H,27,28) |
| InChIKey | PJKLZRADRZIJBK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|