C12H15Cl2NO3 — CID 114297830
5-chloro-N-[2-(2-chloroethoxy)ethyl]-2-methoxybenzamide (PubChem CID 114297830) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-chloroethoxy)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-(2-chloroethoxy)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 114297830 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-chloro-N-[2-(2-chloroethoxy)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCOCCCl |
| InChI | InChI=1S/C12H15Cl2NO3/c1-17-11-3-2-9(14)8-10(11)12(16)15-5-7-18-6-4-13/h2-3,8H,4-7H2,1H3,(H,15,16) |
| InChIKey | OCLNROFFOCUXQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|