C14H10Cl3NO — CID 114298395
2,4-dichloro-N-[2-(chloromethyl)phenyl]benzamide (PubChem CID 114298395) has the molecular formula C14H10Cl3NO and a molecular weight of 314.60 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(chloromethyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(chloromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 114298395 |
| Molecular Formula | C14H10Cl3NO |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 2,4-dichloro-N-[2-(chloromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3NO/c15-8-9-3-1-2-4-13(9)18-14(19)11-6-5-10(16)7-12(11)17/h1-7H,8H2,(H,18,19) |
| InChIKey | RJMYYKQGXFXRNG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|