C10H13ClN2O3 — CID 114298783
N-(2-chloro-3-methoxypropyl)-3-hydroxypyridine-4-carboxamide (PubChem CID 114298783) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-3-hydroxypyridine-4-carboxamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-3-hydroxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 114298783 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-3-hydroxypyridine-4-carboxamide |
| SMILES | COCC(Cl)CNC(=O)c1ccncc1O |
| InChI | InChI=1S/C10H13ClN2O3/c1-16-6-7(11)4-13-10(15)8-2-3-12-5-9(8)14/h2-3,5,7,14H,4,6H2,1H3,(H,13,15) |
| InChIKey | BJNIUMLAUOREDV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|