C15H20ClNO2 — CID 114299310
N-[4-(2-chloroethyl)phenyl]-3-(oxolan-2-yl)propanamide (PubChem CID 114299310) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is N-[4-(2-chloroethyl)phenyl]-3-(oxolan-2-yl)propanamide.
| Compound Name | N-[4-(2-chloroethyl)phenyl]-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 114299310 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[4-(2-chloroethyl)phenyl]-3-(oxolan-2-yl)propanamide |
| SMILES | O=C(CCC1CCCO1)Nc1ccc(CCCl)cc1 |
| InChI | InChI=1S/C15H20ClNO2/c16-10-9-12-3-5-13(6-4-12)17-15(18)8-7-14-2-1-11-19-14/h3-6,14H,1-2,7-11H2,(H,17,18) |
| InChIKey | PXGYEZYYYIOGET-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|