C17H20ClNO — CID 114300984
N-(1-chloro-4-methylpentan-2-yl)naphthalene-2-carboxamide (PubChem CID 114300984) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-2-yl)naphthalene-2-carboxamide.
| Compound Name | N-(1-chloro-4-methylpentan-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 114300984 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-(1-chloro-4-methylpentan-2-yl)naphthalene-2-carboxamide |
| SMILES | CC(C)CC(CCl)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20ClNO/c1-12(2)9-16(11-18)19-17(20)15-8-7-13-5-3-4-6-14(13)10-15/h3-8,10,12,16H,9,11H2,1-2H3,(H,19,20) |
| InChIKey | GLLYQJJLEVIJDM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|