About [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone (PubChem CID 11430126) has the molecular formula C18H23N5O3S2
and a molecular weight of 421.55 g/mol. Its IUPAC name is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone.
Molecular Properties
| Compound Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone |
| PubChem CID | 11430126 |
| Molecular Formula | C18H23N5O3S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone |
| SMILES | COc1cc2nc(N3CCN(C(=O)C4CCSS4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C18H23N5O3S2/c1-25-13-9-11-12(10-14(13)26-2)20-18(21-16(11)19)23-6-4-22(5-7-23)17(24)15-3-8-27-28-15/h9-10,15H,3-8H2,1-2H3,(H2,19,20,21) |
| InChIKey | PUSDBRIZNFZIFK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone?
The IUPAC name of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone (CID 11430126) is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone.
What is the SMILES notation for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone?
The canonical SMILES for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone is COc1cc2nc(N3CCN(C(=O)C4CCSS4)CC3)nc(N)c2cc1OC.
What is the InChIKey of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone?
The InChIKey is PUSDBRIZNFZIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O3S2/c1-25-13-9-11-12(10-14(13)26-2)20-18(21-16(11)19)23-6-4-22(5-7-23)17(24)15-3-8-27-28-15/h9-10,15H,3-8H2,1-2H3,(H2,19,20,21).
What are the key properties of [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone?
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone has a molecular weight of 421.55 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(dithiolan-3-yl)methanone is sourced from PubChem (CID 11430126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).