C15H19BrClNO2 — CID 114301502
3-bromo-N-[(2-chlorocyclohexyl)methyl]-4-methoxybenzamide (PubChem CID 114301502) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is 3-bromo-N-[(2-chlorocyclohexyl)methyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[(2-chlorocyclohexyl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 114301502 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 3-bromo-N-[(2-chlorocyclohexyl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2CCCCC2Cl)cc1Br |
| InChI | InChI=1S/C15H19BrClNO2/c1-20-14-7-6-10(8-12(14)16)15(19)18-9-11-4-2-3-5-13(11)17/h6-8,11,13H,2-5,9H2,1H3,(H,18,19) |
| InChIKey | IONMURULOZYCAY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|