C17H28O8S2 — CID 11430187
[(2S,3S,4R)-2,3,4-triacetyloxy-5,5-bis(ethylsulfanyl)pentyl] acetate (PubChem CID 11430187) has the molecular formula C17H28O8S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3,4-triacetyloxy-5,5-bis(ethylsulfanyl)pentyl] acetate.
| Compound Name | [(2S,3S,4R)-2,3,4-triacetyloxy-5,5-bis(ethylsulfanyl)pentyl] acetate |
|---|---|
| PubChem CID | 11430187 |
| Molecular Formula | C17H28O8S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [(2S,3S,4R)-2,3,4-triacetyloxy-5,5-bis(ethylsulfanyl)pentyl] acetate |
| SMILES | CCSC(SCC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H28O8S2/c1-7-26-17(27-8-2)16(25-13(6)21)15(24-12(5)20)14(23-11(4)19)9-22-10(3)18/h14-17H,7-9H2,1-6H3/t14-,15-,16+/m0/s1 |
| InChIKey | OGSWVSGRSHUBOP-HRCADAONSA-N |
| XLogP | 2.18 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|