C15H20ClNOS — CID 114303134
N-[(2-chlorocyclopentyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxamide (PubChem CID 114303134) has the molecular formula C15H20ClNOS and a molecular weight of 297.85 g/mol. Its IUPAC name is N-[(2-chlorocyclopentyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxamide.
| Compound Name | N-[(2-chlorocyclopentyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 114303134 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[(2-chlorocyclopentyl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NCC1CCCC1Cl)C1CCCc2sccc21 |
| InChI | InChI=1S/C15H20ClNOS/c16-13-5-1-3-10(13)9-17-15(18)12-4-2-6-14-11(12)7-8-19-14/h7-8,10,12-13H,1-6,9H2,(H,17,18) |
| InChIKey | HKUQLABMRDMJCE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|