C23H23N3O4S — CID 1143042
cyclohexyl 2-[[5-(2-benzamidophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 1143042) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is cyclohexyl 2-[[5-(2-benzamidophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | cyclohexyl 2-[[5-(2-benzamidophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 1143042 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | cyclohexyl 2-[[5-(2-benzamidophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(-c2ccccc2NC(=O)c2ccccc2)o1)OC1CCCCC1 |
| InChI | InChI=1S/C23H23N3O4S/c27-20(29-17-11-5-2-6-12-17)15-31-23-26-25-22(30-23)18-13-7-8-14-19(18)24-21(28)16-9-3-1-4-10-16/h1,3-4,7-10,13-14,17H,2,5-6,11-12,15H2,(H,24,28) |
| InChIKey | SRHAHRLCEPIHRR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |