C16H28ClNO — CID 114304280
N-[1-(chloromethyl)-4-methylcyclohexyl]cycloheptanecarboxamide (PubChem CID 114304280) has the molecular formula C16H28ClNO and a molecular weight of 285.86 g/mol. Its IUPAC name is N-[1-(chloromethyl)-4-methylcyclohexyl]cycloheptanecarboxamide.
| Compound Name | N-[1-(chloromethyl)-4-methylcyclohexyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 114304280 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-[1-(chloromethyl)-4-methylcyclohexyl]cycloheptanecarboxamide |
| SMILES | CC1CCC(CCl)(NC(=O)C2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H28ClNO/c1-13-8-10-16(12-17,11-9-13)18-15(19)14-6-4-2-3-5-7-14/h13-14H,2-12H2,1H3,(H,18,19) |
| InChIKey | VGMBEDWOXWZRBO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|