C24H42O5Si — CID 11430569
(1R,2S,3S,6R,7R,11S,12S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-2,6,9,9,13,13-hexamethyl-8,10,14-trioxatetracyclo[10.2.1.01,6.07,11]pentadec-4-en-3-ol (PubChem CID 11430569) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,11S,12S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-2,6,9,9,13,13-hexamethyl-8,10,14-trioxatetracyclo[10.2.1.01,6.07,11]pentadec-4-en-3-ol.
| Compound Name | (1R,2S,3S,6R,7R,11S,12S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-2,6,9,9,13,13-hexamethyl-8,10,14-trioxatetracyclo[10.2.1.01,6.07,11]pentadec-4-en-3-ol |
|---|---|
| PubChem CID | 11430569 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (1R,2S,3S,6R,7R,11S,12S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-2,6,9,9,13,13-hexamethyl-8,10,14-trioxatetracyclo[10.2.1.01,6.07,11]pentadec-4-en-3-ol |
| SMILES | C[C@H]1[C@@H](O)C=C[C@]2(C)[C@H]3OC(C)(C)O[C@H]3[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@]12OC3(C)C |
| InChI | InChI=1S/C24H42O5Si/c1-14-15(25)12-13-23(9)19-17(26-22(7,8)27-19)16-18(24(14,23)29-21(16,5)6)28-30(10,11)20(2,3)4/h12-19,25H,1-11H3/t14-,15-,16-,17-,18-,19-,23+,24-/m0/s1 |
| InChIKey | PXZCELVIZKHNNJ-FQLSSJAKSA-N |
| XLogP | 4.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|