C25H32O5Si — CID 11430603
(3aR,6S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one (PubChem CID 11430603) has the molecular formula C25H32O5Si and a molecular weight of 440.61 g/mol. Its IUPAC name is (3aR,6S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one.
| Compound Name | (3aR,6S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
|---|---|
| PubChem CID | 11430603 |
| Molecular Formula | C25H32O5Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (3aR,6S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
| SMILES | CC1(C)O[C@@H]2C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C25H32O5Si/c1-24(2,3)31(19-12-8-6-9-13-19,20-14-10-7-11-15-20)27-17-18-16-21-22(23(26)28-18)30-25(4,5)29-21/h6-15,18,21-22H,16-17H2,1-5H3/t18-,21+,22+/m0/s1 |
| InChIKey | JKACQIUCUZIRAH-VLCRHTCISA-N |
| XLogP | 3.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|