C28H40O4 — CID 11430604
(4R,5S,6S)-6-[(2S)-3-[(4-methoxyphenyl)methoxy]-2-methylpropanoyl]-2,4,6-trimethyl-5-[(E)-5-methylhex-2-en-2-yl]cyclohex-2-en-1-one (PubChem CID 11430604) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is (4R,5S,6S)-6-[(2S)-3-[(4-methoxyphenyl)methoxy]-2-methylpropanoyl]-2,4,6-trimethyl-5-[(E)-5-methylhex-2-en-2-yl]cyclohex-2-en-1-one.
| Compound Name | (4R,5S,6S)-6-[(2S)-3-[(4-methoxyphenyl)methoxy]-2-methylpropanoyl]-2,4,6-trimethyl-5-[(E)-5-methylhex-2-en-2-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11430604 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (4R,5S,6S)-6-[(2S)-3-[(4-methoxyphenyl)methoxy]-2-methylpropanoyl]-2,4,6-trimethyl-5-[(E)-5-methylhex-2-en-2-yl]cyclohex-2-en-1-one |
| SMILES | COc1ccc(COC[C@H](C)C(=O)[C@@]2(C)C(=O)C(C)=CC(C)[C@H]2/C(C)=C/CC(C)C)cc1 |
| InChI | InChI=1S/C28H40O4/c1-18(2)9-10-19(3)25-20(4)15-21(5)26(29)28(25,7)27(30)22(6)16-32-17-23-11-13-24(31-8)14-12-23/h10-15,18,20,22,25H,9,16-17H2,1-8H3/b19-10+/t20?,22-,25+,28+/m0/s1 |
| InChIKey | FYARMXFBCJAOEV-DXEROCCESA-N |
| XLogP | 6.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|