C25H52O2Si2 — CID 11430610
tert-butyl-[(3S,4S,5E,8R)-3,6-dimethyl-8-triethylsilyloxyundeca-1,5-dien-4-yl]oxy-dimethylsilane (PubChem CID 11430610) has the molecular formula C25H52O2Si2 and a molecular weight of 440.86 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5E,8R)-3,6-dimethyl-8-triethylsilyloxyundeca-1,5-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5E,8R)-3,6-dimethyl-8-triethylsilyloxyundeca-1,5-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11430610 |
| Molecular Formula | C25H52O2Si2 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | tert-butyl-[(3S,4S,5E,8R)-3,6-dimethyl-8-triethylsilyloxyundeca-1,5-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](C)[C@@H](/C=C(\C)C[C@@H](CCC)O[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O2Si2/c1-13-18-23(26-29(15-3,16-4)17-5)19-21(6)20-24(22(7)14-2)27-28(11,12)25(8,9)10/h14,20,22-24H,2,13,15-19H2,1,3-12H3/b21-20+/t22-,23+,24+/m0/s1 |
| InChIKey | WGZPLGLPGMGOTE-SACSPNCMSA-N |
| XLogP | 8.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|