C15H24ClN3O — CID 114307110
N-[[2-(chloromethyl)cyclohexyl]methyl]-2-ethyl-5-methylpyrazole-3-carboxamide (PubChem CID 114307110) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclohexyl]methyl]-2-ethyl-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[[2-(chloromethyl)cyclohexyl]methyl]-2-ethyl-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114307110 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[[2-(chloromethyl)cyclohexyl]methyl]-2-ethyl-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)NCC1CCCCC1CCl |
| InChI | InChI=1S/C15H24ClN3O/c1-3-19-14(8-11(2)18-19)15(20)17-10-13-7-5-4-6-12(13)9-16/h8,12-13H,3-7,9-10H2,1-2H3,(H,17,20) |
| InChIKey | UOXSGRLRVPIKGM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|