About 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile
2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile (PubChem CID 11430712) has the molecular formula C21H15BrF2N2O2
and a molecular weight of 445.26 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile |
| PubChem CID | 11430712 |
| Molecular Formula | C21H15BrF2N2O2 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1ccccc1C#N |
| InChI | InChI=1S/C21H15BrF2N2O2/c1-13-8-19(28-12-16-6-7-17(23)9-18(16)24)20(22)21(27)26(13)11-15-5-3-2-4-14(15)10-25/h2-9H,11-12H2,1H3 |
| InChIKey | IEDSFKUOLQRVGX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile?
The IUPAC name of 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile (CID 11430712) is 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile.
What is the SMILES notation for 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile?
The canonical SMILES for 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile is Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1ccccc1C#N.
What is the InChIKey of 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile?
The InChIKey is IEDSFKUOLQRVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrF2N2O2/c1-13-8-19(28-12-16-6-7-17(23)9-18(16)24)20(22)21(27)26(13)11-15-5-3-2-4-14(15)10-25/h2-9H,11-12H2,1H3.
What are the key properties of 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile?
2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile has a molecular weight of 445.26 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]benzonitrile is sourced from PubChem (CID 11430712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).