About 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene
1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene (PubChem CID 11430754) has the molecular formula C29H34O2S
and a molecular weight of 446.66 g/mol. Its IUPAC name is 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene.
Molecular Properties
| Compound Name | 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene |
| PubChem CID | 11430754 |
| Molecular Formula | C29H34O2S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene |
| SMILES | CCCCCCCC/C(=C(\c1ccccc1)c1ccc(S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H34O2S/c1-3-4-5-6-7-14-19-28(24-15-10-8-11-16-24)29(25-17-12-9-13-18-25)26-20-22-27(23-21-26)32(2,30)31/h8-13,15-18,20-23H,3-7,14,19H2,1-2H3/b29-28- |
| InChIKey | MSQATXNWZSMZKT-ZIADKAODSA-N |
| XLogP | 7.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene?
The IUPAC name of 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene (CID 11430754) is 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene.
What is the SMILES notation for 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene?
The canonical SMILES for 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene is CCCCCCCC/C(=C(\c1ccccc1)c1ccc(S(C)(=O)=O)cc1)c1ccccc1.
What is the InChIKey of 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene?
The InChIKey is MSQATXNWZSMZKT-ZIADKAODSA-N. The full InChI is InChI=1S/C29H34O2S/c1-3-4-5-6-7-14-19-28(24-15-10-8-11-16-24)29(25-17-12-9-13-18-25)26-20-22-27(23-21-26)32(2,30)31/h8-13,15-18,20-23H,3-7,14,19H2,1-2H3/b29-28-.
What are the key properties of 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene?
1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene has a molecular weight of 446.66 g/mol, XLogP of 7.80, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-1,2-diphenyldec-1-enyl]-4-methylsulfonylbenzene is sourced from PubChem (CID 11430754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).