About N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide
N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide (PubChem CID 114308130) has the molecular formula C7H11BrF3NO
and a molecular weight of 262.07 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide |
| PubChem CID | 114308130 |
| Molecular Formula | C7H11BrF3NO |
| Molecular Weight | 262.07 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide |
| SMILES | CC(C)(CBr)NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C7H11BrF3NO/c1-6(2,4-8)12-5(13)3-7(9,10)11/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | GRICDNDJOOTMIQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide (CID 114308130) is N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide is CC(C)(CBr)NC(=O)CC(F)(F)F.
What is the InChIKey of N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide?
The InChIKey is GRICDNDJOOTMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrF3NO/c1-6(2,4-8)12-5(13)3-7(9,10)11/h3-4H2,1-2H3,(H,12,13).
What are the key properties of N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide?
N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide has a molecular weight of 262.07 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-bromo-2-methylpropan-2-yl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 114308130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).