About 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid
6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11430936) has the molecular formula C18H10Cl3F3O4
and a molecular weight of 453.63 g/mol. Its IUPAC name is 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| PubChem CID | 11430936 |
| Molecular Formula | C18H10Cl3F3O4 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(Cl)c1Oc1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C18H10Cl3F3O4/c1-7-2-9(19)5-12(21)15(7)27-14-6-13-8(4-11(14)20)3-10(17(25)26)16(28-13)18(22,23)24/h2-6,16H,1H3,(H,25,26) |
| InChIKey | OCWHPGINAMPTQF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The IUPAC name of 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (CID 11430936) is 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The canonical SMILES for 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid is Cc1cc(Cl)cc(Cl)c1Oc1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2.
What is the InChIKey of 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The InChIKey is OCWHPGINAMPTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl3F3O4/c1-7-2-9(19)5-12(21)15(7)27-14-6-13-8(4-11(14)20)3-10(17(25)26)16(28-13)18(22,23)24/h2-6,16H,1H3,(H,25,26).
What are the key properties of 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid has a molecular weight of 453.63 g/mol, XLogP of 6.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-(2,4-dichloro-6-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 11430936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).