C28H20Cl2Si — CID 11430979
1,1-dichloro-2,3,4,5-tetraphenylsilole (PubChem CID 11430979) has the molecular formula C28H20Cl2Si and a molecular weight of 455.46 g/mol. Its IUPAC name is 1,1-dichloro-2,3,4,5-tetraphenylsilole.
| Compound Name | 1,1-dichloro-2,3,4,5-tetraphenylsilole |
|---|---|
| PubChem CID | 11430979 |
| Molecular Formula | C28H20Cl2Si |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 1,1-dichloro-2,3,4,5-tetraphenylsilole |
| SMILES | Cl[Si]1(Cl)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2Si/c29-31(30)27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(31)24-19-11-4-12-20-24/h1-20H |
| InChIKey | HBMGBSZUXZVZTH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|